About [(1S)-1-(4-fluorophenyl)ethyl] 3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoate
[(1S)-1-(4-fluorophenyl)ethyl] 3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoate (PubChem CID 38862306) has the molecular formula C18H16FN3O3
and a molecular weight of 341.34 g/mol. Its IUPAC name is [(1S)-1-(4-fluorophenyl)ethyl] 3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoate.
Molecular Properties
| Compound Name | [(1S)-1-(4-fluorophenyl)ethyl] 3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoate |
| PubChem CID | 38862306 |
| Molecular Formula | C18H16FN3O3 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | [(1S)-1-(4-fluorophenyl)ethyl] 3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoate |
| SMILES | C[C@H](OC(=O)CCn1nnc2ccccc2c1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H16FN3O3/c1-12(13-6-8-14(19)9-7-13)25-17(23)10-11-22-18(24)15-4-2-3-5-16(15)20-21-22/h2-9,12H,10-11H2,1H3/t12-/m0/s1 |
| InChIKey | OEQDJIXOBCPWTH-LBPRGKRZSA-N |
| XLogP | 2.63 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(1S)-1-(4-fluorophenyl)ethyl] 3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-(4-fluorophenyl)ethyl] 3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoate?
The IUPAC name of [(1S)-1-(4-fluorophenyl)ethyl] 3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoate (CID 38862306) is [(1S)-1-(4-fluorophenyl)ethyl] 3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoate.
What is the SMILES notation for [(1S)-1-(4-fluorophenyl)ethyl] 3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoate?
The canonical SMILES for [(1S)-1-(4-fluorophenyl)ethyl] 3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoate is C[C@H](OC(=O)CCn1nnc2ccccc2c1=O)c1ccc(F)cc1.
What is the InChIKey of [(1S)-1-(4-fluorophenyl)ethyl] 3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoate?
The InChIKey is OEQDJIXOBCPWTH-LBPRGKRZSA-N. The full InChI is InChI=1S/C18H16FN3O3/c1-12(13-6-8-14(19)9-7-13)25-17(23)10-11-22-18(24)15-4-2-3-5-16(15)20-21-22/h2-9,12H,10-11H2,1H3/t12-/m0/s1.
What are the key properties of [(1S)-1-(4-fluorophenyl)ethyl] 3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoate?
[(1S)-1-(4-fluorophenyl)ethyl] 3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoate has a molecular weight of 341.34 g/mol, XLogP of 2.63, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-(4-fluorophenyl)ethyl] 3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoate is sourced from PubChem (CID 38862306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).