C28H35N3O10 — CID 118380469
[2-[(2-methylpropan-2-yl)oxy]-1-(2-nitrophenyl)-2-oxoethyl] 4-[[2-[(2-methylpropan-2-yl)oxy]-1-(2-nitrophenyl)-2-oxoethyl]amino]butanoate (PubChem CID 118380469) has the molecular formula C28H35N3O10 and a molecular weight of 573.60 g/mol. Its IUPAC name is [2-[(2-methylpropan-2-yl)oxy]-1-(2-nitrophenyl)-2-oxoethyl] 4-[[2-[(2-methylpropan-2-yl)oxy]-1-(2-nitrophenyl)-2-oxoethyl]amino]butanoate.
| Compound Name | [2-[(2-methylpropan-2-yl)oxy]-1-(2-nitrophenyl)-2-oxoethyl] 4-[[2-[(2-methylpropan-2-yl)oxy]-1-(2-nitrophenyl)-2-oxoethyl]amino]butanoate |
|---|---|
| PubChem CID | 118380469 |
| Molecular Formula | C28H35N3O10 |
| Molecular Weight | 573.60 g/mol |
| Exact Mass | 573.23 |
| IUPAC Name | [2-[(2-methylpropan-2-yl)oxy]-1-(2-nitrophenyl)-2-oxoethyl] 4-[[2-[(2-methylpropan-2-yl)oxy]-1-(2-nitrophenyl)-2-oxoethyl]amino]butanoate |
| SMILES | CC(C)(C)OC(=O)C(NCCCC(=O)OC(C(=O)OC(C)(C)C)c1ccccc1[N+](=O)[O-])c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H35N3O10/c1-27(2,3)40-25(33)23(18-12-7-9-14-20(18)30(35)36)29-17-11-16-22(32)39-24(26(34)41-28(4,5)6)19-13-8-10-15-21(19)31(37)38/h7-10,12-15,23-24,29H,11,16-17H2,1-6H3 |
| InChIKey | PMNHJEQYKFVNTB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 177.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|