C19H26N2O8 — CID 11704252
diethyl 2-[[(2-methylpropan-2-yl)oxycarbonylamino]-(2-nitrophenyl)methyl]propanedioate (PubChem CID 11704252) has the molecular formula C19H26N2O8 and a molecular weight of 410.42 g/mol. Its IUPAC name is diethyl 2-[[(2-methylpropan-2-yl)oxycarbonylamino]-(2-nitrophenyl)methyl]propanedioate.
| Compound Name | diethyl 2-[[(2-methylpropan-2-yl)oxycarbonylamino]-(2-nitrophenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 11704252 |
| Molecular Formula | C19H26N2O8 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | diethyl 2-[[(2-methylpropan-2-yl)oxycarbonylamino]-(2-nitrophenyl)methyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(NC(=O)OC(C)(C)C)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H26N2O8/c1-6-27-16(22)14(17(23)28-7-2)15(20-18(24)29-19(3,4)5)12-10-8-9-11-13(12)21(25)26/h8-11,14-15H,6-7H2,1-5H3,(H,20,24) |
| InChIKey | IVJZGNATFLDKSW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|