C13H15N3O4 — CID 11288917
tert-butyl N-[cyano-(2-nitrophenyl)methyl]carbamate (PubChem CID 11288917) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is tert-butyl N-[cyano-(2-nitrophenyl)methyl]carbamate.
| Compound Name | tert-butyl N-[cyano-(2-nitrophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 11288917 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | tert-butyl N-[cyano-(2-nitrophenyl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C#N)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15N3O4/c1-13(2,3)20-12(17)15-10(8-14)9-6-4-5-7-11(9)16(18)19/h4-7,10H,1-3H3,(H,15,17) |
| InChIKey | IDXKRVYABRIGJJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|