C18H29NO9Si — CID 102027643
1-(4,5-dimethoxy-2-nitrophenyl)ethyl 5-trimethoxysilylpentanoate (PubChem CID 102027643) has the molecular formula C18H29NO9Si and a molecular weight of 431.51 g/mol. Its IUPAC name is 1-(4,5-dimethoxy-2-nitrophenyl)ethyl 5-trimethoxysilylpentanoate.
| Compound Name | 1-(4,5-dimethoxy-2-nitrophenyl)ethyl 5-trimethoxysilylpentanoate |
|---|---|
| PubChem CID | 102027643 |
| Molecular Formula | C18H29NO9Si |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 1-(4,5-dimethoxy-2-nitrophenyl)ethyl 5-trimethoxysilylpentanoate |
| SMILES | COc1cc(C(C)OC(=O)CCCC[Si](OC)(OC)OC)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H29NO9Si/c1-13(14-11-16(23-2)17(24-3)12-15(14)19(21)22)28-18(20)9-7-8-10-29(25-4,26-5)27-6/h11-13H,7-10H2,1-6H3 |
| InChIKey | CMFMJJISXAPUPX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 115.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|