C12H15ClN2O6 — CID 70608404
(2S)-2-amino-3-[3-(carboxymethyl)-4-nitrophenyl]-2-methylpropanoic acid;hydrochloride (PubChem CID 70608404) has the molecular formula C12H15ClN2O6 and a molecular weight of 318.71 g/mol. Its IUPAC name is (2S)-2-amino-3-[3-(carboxymethyl)-4-nitrophenyl]-2-methylpropanoic acid;hydrochloride.
| Compound Name | (2S)-2-amino-3-[3-(carboxymethyl)-4-nitrophenyl]-2-methylpropanoic acid;hydrochloride |
|---|---|
| PubChem CID | 70608404 |
| Molecular Formula | C12H15ClN2O6 |
| Molecular Weight | 318.71 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | (2S)-2-amino-3-[3-(carboxymethyl)-4-nitrophenyl]-2-methylpropanoic acid;hydrochloride |
| SMILES | C[C@](N)(Cc1ccc([N+](=O)[O-])c(CC(=O)O)c1)C(=O)O.Cl |
| InChI | InChI=1S/C12H14N2O6.ClH/c1-12(13,11(17)18)6-7-2-3-9(14(19)20)8(4-7)5-10(15)16;/h2-4H,5-6,13H2,1H3,(H,15,16)(H,17,18);1H/t12-;/m0./s1 |
| InChIKey | AQRQKLUHRKTKGD-YDALLXLXSA-N |
| XLogP | 0.99 |
| TPSA | 143.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.71 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|