C11H13BrN2O4 — CID 170885128
ethyl 2-amino-3-(4-bromo-3-nitrophenyl)propanoate (PubChem CID 170885128) has the molecular formula C11H13BrN2O4 and a molecular weight of 317.14 g/mol. Its IUPAC name is ethyl 2-amino-3-(4-bromo-3-nitrophenyl)propanoate.
| Compound Name | ethyl 2-amino-3-(4-bromo-3-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 170885128 |
| Molecular Formula | C11H13BrN2O4 |
| Molecular Weight | 317.14 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | ethyl 2-amino-3-(4-bromo-3-nitrophenyl)propanoate |
| SMILES | CCOC(=O)C(N)Cc1ccc(Br)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H13BrN2O4/c1-2-18-11(15)9(13)5-7-3-4-8(12)10(6-7)14(16)17/h3-4,6,9H,2,5,13H2,1H3 |
| InChIKey | PVLYWSUFDXRODT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.14 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|