C18H22N2O8S — CID 87235623
ethyl (2S)-2-amino-3-(4-hydroxy-3-nitrophenyl)propanoate;4-methylbenzenesulfonic acid (PubChem CID 87235623) has the molecular formula C18H22N2O8S and a molecular weight of 426.45 g/mol. Its IUPAC name is ethyl (2S)-2-amino-3-(4-hydroxy-3-nitrophenyl)propanoate;4-methylbenzenesulfonic acid.
| Compound Name | ethyl (2S)-2-amino-3-(4-hydroxy-3-nitrophenyl)propanoate;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 87235623 |
| Molecular Formula | C18H22N2O8S |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | ethyl (2S)-2-amino-3-(4-hydroxy-3-nitrophenyl)propanoate;4-methylbenzenesulfonic acid |
| SMILES | CCOC(=O)[C@@H](N)Cc1ccc(O)c([N+](=O)[O-])c1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C11H14N2O5.C7H8O3S/c1-2-18-11(15)8(12)5-7-3-4-10(14)9(6-7)13(16)17;1-6-2-4-7(5-3-6)11(8,9)10/h3-4,6,8,14H,2,5,12H2,1H3;2-5H,1H3,(H,8,9,10)/t8-;/m0./s1 |
| InChIKey | WGQVEFOITITBLX-QRPNPIFTSA-N |
| XLogP | 1.98 |
| TPSA | 170.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|