C36H44N2O11S2 — CID 123551906
2-[2-(2-amino-3-phenylpropanoyl)oxyethoxy]ethyl 2-amino-3-phenylpropanoate;bis(4-methylbenzenesulfonic acid) (PubChem CID 123551906) has the molecular formula C36H44N2O11S2 and a molecular weight of 744.89 g/mol. Its IUPAC name is 2-[2-(2-amino-3-phenylpropanoyl)oxyethoxy]ethyl 2-amino-3-phenylpropanoate;bis(4-methylbenzenesulfonic acid).
| Compound Name | 2-[2-(2-amino-3-phenylpropanoyl)oxyethoxy]ethyl 2-amino-3-phenylpropanoate;bis(4-methylbenzenesulfonic acid) |
|---|---|
| PubChem CID | 123551906 |
| Molecular Formula | C36H44N2O11S2 |
| Molecular Weight | 744.89 g/mol |
| Exact Mass | 744.24 |
| IUPAC Name | 2-[2-(2-amino-3-phenylpropanoyl)oxyethoxy]ethyl 2-amino-3-phenylpropanoate;bis(4-methylbenzenesulfonic acid) |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.Cc1ccc(S(=O)(=O)O)cc1.NC(Cc1ccccc1)C(=O)OCCOCCOC(=O)C(N)Cc1ccccc1 |
| InChI | InChI=1S/C22H28N2O5.2C7H8O3S/c23-19(15-17-7-3-1-4-8-17)21(25)28-13-11-27-12-14-29-22(26)20(24)16-18-9-5-2-6-10-18;2*1-6-2-4-7(5-3-6)11(8,9)10/h1-10,19-20H,11-16,23-24H2;2*2-5H,1H3,(H,8,9,10) |
| InChIKey | VWUZWTXQMAMPHK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 222.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.89 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|