C16H17N3O7 — CID 70414235
ethyl 4-[3-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-4-nitrophenoxy]butanoate (PubChem CID 70414235) has the molecular formula C16H17N3O7 and a molecular weight of 363.33 g/mol. Its IUPAC name is ethyl 4-[3-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-4-nitrophenoxy]butanoate.
| Compound Name | ethyl 4-[3-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-4-nitrophenoxy]butanoate |
|---|---|
| PubChem CID | 70414235 |
| Molecular Formula | C16H17N3O7 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | ethyl 4-[3-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-4-nitrophenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1ccc([N+](=O)[O-])c(/C=C2/NC(=O)NC2=O)c1 |
| InChI | InChI=1S/C16H17N3O7/c1-2-25-14(20)4-3-7-26-11-5-6-13(19(23)24)10(8-11)9-12-15(21)18-16(22)17-12/h5-6,8-9H,2-4,7H2,1H3,(H2,17,18,21,22)/b12-9+ |
| InChIKey | WOLPRWASQDONPC-FMIVXFBMSA-N |
| XLogP | 1.50 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|