C17H19N3O7 — CID 70415098
ethyl 5-[3-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-4-nitrophenoxy]pentanoate (PubChem CID 70415098) has the molecular formula C17H19N3O7 and a molecular weight of 377.35 g/mol. Its IUPAC name is ethyl 5-[3-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-4-nitrophenoxy]pentanoate.
| Compound Name | ethyl 5-[3-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-4-nitrophenoxy]pentanoate |
|---|---|
| PubChem CID | 70415098 |
| Molecular Formula | C17H19N3O7 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | ethyl 5-[3-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-4-nitrophenoxy]pentanoate |
| SMILES | CCOC(=O)CCCCOc1ccc([N+](=O)[O-])c(/C=C2/NC(=O)NC2=O)c1 |
| InChI | InChI=1S/C17H19N3O7/c1-2-26-15(21)5-3-4-8-27-12-6-7-14(20(24)25)11(9-12)10-13-16(22)19-17(23)18-13/h6-7,9-10H,2-5,8H2,1H3,(H2,18,19,22,23)/b13-10+ |
| InChIKey | HKXQWBCNCDWHCP-JLHYYAGUSA-N |
| XLogP | 1.89 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|