C20H25N5O6 — CID 19773210
1-cyclohexyl-3-[3-[3-[(Z)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-4-nitrophenoxy]propyl]urea (PubChem CID 19773210) has the molecular formula C20H25N5O6 and a molecular weight of 431.45 g/mol. Its IUPAC name is 1-cyclohexyl-3-[3-[3-[(Z)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-4-nitrophenoxy]propyl]urea.
| Compound Name | 1-cyclohexyl-3-[3-[3-[(Z)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-4-nitrophenoxy]propyl]urea |
|---|---|
| PubChem CID | 19773210 |
| Molecular Formula | C20H25N5O6 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 1-cyclohexyl-3-[3-[3-[(Z)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-4-nitrophenoxy]propyl]urea |
| SMILES | O=C1NC(=O)/C(=C/c2cc(OCCCNC(=O)NC3CCCCC3)ccc2[N+](=O)[O-])N1 |
| InChI | InChI=1S/C20H25N5O6/c26-18-16(23-20(28)24-18)12-13-11-15(7-8-17(13)25(29)30)31-10-4-9-21-19(27)22-14-5-2-1-3-6-14/h7-8,11-12,14H,1-6,9-10H2,(H2,21,22,27)(H2,23,24,26,28)/b16-12- |
| InChIKey | ANCMUDJPSBAAJY-VBKFSLOCSA-N |
| XLogP | 2.18 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|