C15H15N3O7 — CID 70414611
5-[3-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-4-nitrophenoxy]pentanoic acid (PubChem CID 70414611) has the molecular formula C15H15N3O7 and a molecular weight of 349.30 g/mol. Its IUPAC name is 5-[3-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-4-nitrophenoxy]pentanoic acid.
| Compound Name | 5-[3-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-4-nitrophenoxy]pentanoic acid |
|---|---|
| PubChem CID | 70414611 |
| Molecular Formula | C15H15N3O7 |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 5-[3-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-4-nitrophenoxy]pentanoic acid |
| SMILES | O=C(O)CCCCOc1ccc([N+](=O)[O-])c(/C=C2/NC(=O)NC2=O)c1 |
| InChI | InChI=1S/C15H15N3O7/c19-13(20)3-1-2-6-25-10-4-5-12(18(23)24)9(7-10)8-11-14(21)17-15(22)16-11/h4-5,7-8H,1-3,6H2,(H,19,20)(H2,16,17,21,22)/b11-8+ |
| InChIKey | NWVHTRKZGOREJS-DHZHZOJOSA-N |
| XLogP | 1.41 |
| TPSA | 147.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|