C18H18N2O8S2 — CID 72655521
4-[5-[[5-(3-carboxypropoxy)-2-nitrophenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 72655521) has the molecular formula C18H18N2O8S2 and a molecular weight of 454.48 g/mol. Its IUPAC name is 4-[5-[[5-(3-carboxypropoxy)-2-nitrophenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 4-[5-[[5-(3-carboxypropoxy)-2-nitrophenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 72655521 |
| Molecular Formula | C18H18N2O8S2 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | 4-[5-[[5-(3-carboxypropoxy)-2-nitrophenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | O=C(O)CCCOc1ccc([N+](=O)[O-])c(C=C2SC(=S)N(CCCC(=O)O)C2=O)c1 |
| InChI | InChI=1S/C18H18N2O8S2/c21-15(22)3-1-7-19-17(25)14(30-18(19)29)10-11-9-12(5-6-13(11)20(26)27)28-8-2-4-16(23)24/h5-6,9-10H,1-4,7-8H2,(H,21,22)(H,23,24) |
| InChIKey | VWCNOCXASYGNFE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 147.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|