C16H15NO6S2 — CID 14461601
4-[(5Z)-5-[[4-(carboxymethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 14461601) has the molecular formula C16H15NO6S2 and a molecular weight of 381.43 g/mol. Its IUPAC name is 4-[(5Z)-5-[[4-(carboxymethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 4-[(5Z)-5-[[4-(carboxymethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 14461601 |
| Molecular Formula | C16H15NO6S2 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | 4-[(5Z)-5-[[4-(carboxymethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)/C(=C/c2ccc(OCC(=O)O)cc2)SC1=S |
| InChI | InChI=1S/C16H15NO6S2/c18-13(19)2-1-7-17-15(22)12(25-16(17)24)8-10-3-5-11(6-4-10)23-9-14(20)21/h3-6,8H,1-2,7,9H2,(H,18,19)(H,20,21)/b12-8- |
| InChIKey | ZJZWSMVJMSTYPE-WQLSENKSSA-N |
| XLogP | 2.22 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|