C23H23NO5S2 — CID 75409242
4-[(5E)-5-[[4-[2-(2-methylphenoxy)ethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 75409242) has the molecular formula C23H23NO5S2 and a molecular weight of 457.57 g/mol. Its IUPAC name is 4-[(5E)-5-[[4-[2-(2-methylphenoxy)ethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 4-[(5E)-5-[[4-[2-(2-methylphenoxy)ethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 75409242 |
| Molecular Formula | C23H23NO5S2 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 4-[(5E)-5-[[4-[2-(2-methylphenoxy)ethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | Cc1ccccc1OCCOc1ccc(/C=C2/SC(=S)N(CCCC(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C23H23NO5S2/c1-16-5-2-3-6-19(16)29-14-13-28-18-10-8-17(9-11-18)15-20-22(27)24(23(30)31-20)12-4-7-21(25)26/h2-3,5-6,8-11,15H,4,7,12-14H2,1H3,(H,25,26)/b20-15+ |
| InChIKey | RXKZVLWMCCRWPS-HMMYKYKNSA-N |
| XLogP | 4.52 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|