C14H11ClN2O5S2 — CID 72655048
4-[5-[(4-chloro-2-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 72655048) has the molecular formula C14H11ClN2O5S2 and a molecular weight of 386.84 g/mol. Its IUPAC name is 4-[5-[(4-chloro-2-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 4-[5-[(4-chloro-2-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 72655048 |
| Molecular Formula | C14H11ClN2O5S2 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 385.98 |
| IUPAC Name | 4-[5-[(4-chloro-2-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)C(=Cc2ccc(Cl)cc2[N+](=O)[O-])SC1=S |
| InChI | InChI=1S/C14H11ClN2O5S2/c15-9-4-3-8(10(7-9)17(21)22)6-11-13(20)16(14(23)24-11)5-1-2-12(18)19/h3-4,6-7H,1-2,5H2,(H,18,19) |
| InChIKey | LOYBRBGVOANGAW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|