C20H15ClN2O6S2 — CID 72654395
4-[5-[[4-(3-chlorophenoxy)-3-nitrophenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 72654395) has the molecular formula C20H15ClN2O6S2 and a molecular weight of 478.94 g/mol. Its IUPAC name is 4-[5-[[4-(3-chlorophenoxy)-3-nitrophenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 4-[5-[[4-(3-chlorophenoxy)-3-nitrophenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 72654395 |
| Molecular Formula | C20H15ClN2O6S2 |
| Molecular Weight | 478.94 g/mol |
| Exact Mass | 478.01 |
| IUPAC Name | 4-[5-[[4-(3-chlorophenoxy)-3-nitrophenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)C(=Cc2ccc(Oc3cccc(Cl)c3)c([N+](=O)[O-])c2)SC1=S |
| InChI | InChI=1S/C20H15ClN2O6S2/c21-13-3-1-4-14(11-13)29-16-7-6-12(9-15(16)23(27)28)10-17-19(26)22(20(30)31-17)8-2-5-18(24)25/h1,3-4,6-7,9-11H,2,5,8H2,(H,24,25) |
| InChIKey | JWHHSWPSHVFOGH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.94 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|