C15H11F4NO3S2 — CID 72654812
4-[5-[[2-fluoro-4-(trifluoromethyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 72654812) has the molecular formula C15H11F4NO3S2 and a molecular weight of 393.38 g/mol. Its IUPAC name is 4-[5-[[2-fluoro-4-(trifluoromethyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 4-[5-[[2-fluoro-4-(trifluoromethyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 72654812 |
| Molecular Formula | C15H11F4NO3S2 |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | 4-[5-[[2-fluoro-4-(trifluoromethyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)C(=Cc2ccc(C(F)(F)F)cc2F)SC1=S |
| InChI | InChI=1S/C15H11F4NO3S2/c16-10-7-9(15(17,18)19)4-3-8(10)6-11-13(23)20(14(24)25-11)5-1-2-12(21)22/h3-4,6-7H,1-2,5H2,(H,21,22) |
| InChIKey | VLXHPCSLNGSWQL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|