C22H18F4N2O3S2 — CID 11294956
6-[(5Z)-5-[[5-[2-fluoro-5-(trifluoromethyl)phenyl]-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid (PubChem CID 11294956) has the molecular formula C22H18F4N2O3S2 and a molecular weight of 498.52 g/mol. Its IUPAC name is 6-[(5Z)-5-[[5-[2-fluoro-5-(trifluoromethyl)phenyl]-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid.
| Compound Name | 6-[(5Z)-5-[[5-[2-fluoro-5-(trifluoromethyl)phenyl]-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 11294956 |
| Molecular Formula | C22H18F4N2O3S2 |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | 6-[(5Z)-5-[[5-[2-fluoro-5-(trifluoromethyl)phenyl]-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1C(=O)/C(=C/c2cncc(-c3cc(C(F)(F)F)ccc3F)c2)SC1=S |
| InChI | InChI=1S/C22H18F4N2O3S2/c23-17-6-5-15(22(24,25)26)10-16(17)14-8-13(11-27-12-14)9-18-20(31)28(21(32)33-18)7-3-1-2-4-19(29)30/h5-6,8-12H,1-4,7H2,(H,29,30)/b18-9- |
| InChIKey | MIFWOCHIELAUNJ-NVMNQCDNSA-N |
| XLogP | 5.75 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|