C23H19F6NO3S3 — CID 58642214
6-[(5Z)-5-[[4-[3,5-bis(trifluoromethyl)phenyl]-3-methylthiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid (PubChem CID 58642214) has the molecular formula C23H19F6NO3S3 and a molecular weight of 567.60 g/mol. Its IUPAC name is 6-[(5Z)-5-[[4-[3,5-bis(trifluoromethyl)phenyl]-3-methylthiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid.
| Compound Name | 6-[(5Z)-5-[[4-[3,5-bis(trifluoromethyl)phenyl]-3-methylthiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 58642214 |
| Molecular Formula | C23H19F6NO3S3 |
| Molecular Weight | 567.60 g/mol |
| Exact Mass | 567.04 |
| IUPAC Name | 6-[(5Z)-5-[[4-[3,5-bis(trifluoromethyl)phenyl]-3-methylthiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
| SMILES | Cc1c(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)csc1/C=C1\SC(=S)N(CCCCCC(=O)O)C1=O |
| InChI | InChI=1S/C23H19F6NO3S3/c1-12-16(13-7-14(22(24,25)26)9-15(8-13)23(27,28)29)11-35-17(12)10-18-20(33)30(21(34)36-18)6-4-2-3-5-19(31)32/h7-11H,2-6H2,1H3,(H,31,32)/b18-10- |
| InChIKey | STXQOEPHVANPPE-ZDLGFXPLSA-N |
| XLogP | 7.61 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.60 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|