C21H21NO4S3 — CID 85425756
6-[5-[[4-[2-(hydroxymethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid (PubChem CID 85425756) has the molecular formula C21H21NO4S3 and a molecular weight of 447.60 g/mol. Its IUPAC name is 6-[5-[[4-[2-(hydroxymethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid.
| Compound Name | 6-[5-[[4-[2-(hydroxymethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 85425756 |
| Molecular Formula | C21H21NO4S3 |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | 6-[5-[[4-[2-(hydroxymethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1C(=O)C(=Cc2cc(-c3ccccc3CO)cs2)SC1=S |
| InChI | InChI=1S/C21H21NO4S3/c23-12-14-6-3-4-7-17(14)15-10-16(28-13-15)11-18-20(26)22(21(27)29-18)9-5-1-2-8-19(24)25/h3-4,6-7,10-11,13,23H,1-2,5,8-9,12H2,(H,24,25) |
| InChIKey | ICMNNECHBKEPKK-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|