C20H16F3NO3S3 — CID 72980901
6-[4-oxo-2-sulfanylidene-5-[[4-(3,4,5-trifluorophenyl)thiophen-2-yl]methylidene]-1,3-thiazolidin-3-yl]hexanoic acid (PubChem CID 72980901) has the molecular formula C20H16F3NO3S3 and a molecular weight of 471.55 g/mol. Its IUPAC name is 6-[4-oxo-2-sulfanylidene-5-[[4-(3,4,5-trifluorophenyl)thiophen-2-yl]methylidene]-1,3-thiazolidin-3-yl]hexanoic acid.
| Compound Name | 6-[4-oxo-2-sulfanylidene-5-[[4-(3,4,5-trifluorophenyl)thiophen-2-yl]methylidene]-1,3-thiazolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 72980901 |
| Molecular Formula | C20H16F3NO3S3 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.02 |
| IUPAC Name | 6-[4-oxo-2-sulfanylidene-5-[[4-(3,4,5-trifluorophenyl)thiophen-2-yl]methylidene]-1,3-thiazolidin-3-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1C(=O)C(=Cc2cc(-c3cc(F)c(F)c(F)c3)cs2)SC1=S |
| InChI | InChI=1S/C20H16F3NO3S3/c21-14-7-11(8-15(22)18(14)23)12-6-13(29-10-12)9-16-19(27)24(20(28)30-16)5-3-1-2-4-17(25)26/h6-10H,1-5H2,(H,25,26) |
| InChIKey | DSPFEDPRDKUGHP-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|