C21H20FN3O3S2 — CID 58644404
6-[(5Z)-5-[[6-(4-amino-3-fluorophenyl)-2-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid (PubChem CID 58644404) has the molecular formula C21H20FN3O3S2 and a molecular weight of 445.54 g/mol. Its IUPAC name is 6-[(5Z)-5-[[6-(4-amino-3-fluorophenyl)-2-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid.
| Compound Name | 6-[(5Z)-5-[[6-(4-amino-3-fluorophenyl)-2-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 58644404 |
| Molecular Formula | C21H20FN3O3S2 |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | 6-[(5Z)-5-[[6-(4-amino-3-fluorophenyl)-2-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
| SMILES | Nc1ccc(-c2cccc(/C=C3\SC(=S)N(CCCCCC(=O)O)C3=O)n2)cc1F |
| InChI | InChI=1S/C21H20FN3O3S2/c22-15-11-13(8-9-16(15)23)17-6-4-5-14(24-17)12-18-20(28)25(21(29)30-18)10-3-1-2-7-19(26)27/h4-6,8-9,11-12H,1-3,7,10,23H2,(H,26,27)/b18-12- |
| InChIKey | CUGGSCREOBXGEG-PDGQHHTCSA-N |
| XLogP | 4.32 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|