C27H31N3O5S2 — CID 58642656
6-[(5Z)-5-[[6-[2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]-2-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid (PubChem CID 58642656) has the molecular formula C27H31N3O5S2 and a molecular weight of 541.70 g/mol. Its IUPAC name is 6-[(5Z)-5-[[6-[2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]-2-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid.
| Compound Name | 6-[(5Z)-5-[[6-[2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]-2-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 58642656 |
| Molecular Formula | C27H31N3O5S2 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | 6-[(5Z)-5-[[6-[2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]-2-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
| SMILES | CC(C)(C)OC(=O)NCc1ccccc1-c1cccc(/C=C2\SC(=S)N(CCCCCC(=O)O)C2=O)n1 |
| InChI | InChI=1S/C27H31N3O5S2/c1-27(2,3)35-25(34)28-17-18-10-6-7-12-20(18)21-13-9-11-19(29-21)16-22-24(33)30(26(36)37-22)15-8-4-5-14-23(31)32/h6-7,9-13,16H,4-5,8,14-15,17H2,1-3H3,(H,28,34)(H,31,32)/b22-16- |
| InChIKey | QZLGBLBBBBVXAD-JWGURIENSA-N |
| XLogP | 5.62 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|