C17H11Cl2NO3S3 — CID 58642323
3-[(5Z)-5-[[4-(2,4-dichlorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 58642323) has the molecular formula C17H11Cl2NO3S3 and a molecular weight of 444.39 g/mol. Its IUPAC name is 3-[(5Z)-5-[[4-(2,4-dichlorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | 3-[(5Z)-5-[[4-(2,4-dichlorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 58642323 |
| Molecular Formula | C17H11Cl2NO3S3 |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 442.93 |
| IUPAC Name | 3-[(5Z)-5-[[4-(2,4-dichlorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)/C(=C/c2cc(-c3ccc(Cl)cc3Cl)cs2)SC1=S |
| InChI | InChI=1S/C17H11Cl2NO3S3/c18-10-1-2-12(13(19)6-10)9-5-11(25-8-9)7-14-16(23)20(17(24)26-14)4-3-15(21)22/h1-2,5-8H,3-4H2,(H,21,22)/b14-7- |
| InChIKey | AJJWQSSYXPRZFJ-AUWJEWJLSA-N |
| XLogP | 5.40 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|