C13H11NO6S2 — CID 15230919
3-[(5Z)-4-oxo-2-sulfanylidene-5-[(3,4,5-trihydroxyphenyl)methylidene]-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 15230919) has the molecular formula C13H11NO6S2 and a molecular weight of 341.37 g/mol. Its IUPAC name is 3-[(5Z)-4-oxo-2-sulfanylidene-5-[(3,4,5-trihydroxyphenyl)methylidene]-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | 3-[(5Z)-4-oxo-2-sulfanylidene-5-[(3,4,5-trihydroxyphenyl)methylidene]-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 15230919 |
| Molecular Formula | C13H11NO6S2 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | 3-[(5Z)-4-oxo-2-sulfanylidene-5-[(3,4,5-trihydroxyphenyl)methylidene]-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)/C(=C/c2cc(O)c(O)c(O)c2)SC1=S |
| InChI | InChI=1S/C13H11NO6S2/c15-7-3-6(4-8(16)11(7)19)5-9-12(20)14(13(21)22-9)2-1-10(17)18/h3-5,15-16,19H,1-2H2,(H,17,18)/b9-5- |
| InChIKey | LHJUQFNEHXKSMO-UITAMQMPSA-N |
| XLogP | 1.48 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|