C14H10BrNO5S2 — CID 17467859
3-[(5E)-5-[(7-bromo-1,3-benzodioxol-5-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 17467859) has the molecular formula C14H10BrNO5S2 and a molecular weight of 416.27 g/mol. Its IUPAC name is 3-[(5E)-5-[(7-bromo-1,3-benzodioxol-5-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | 3-[(5E)-5-[(7-bromo-1,3-benzodioxol-5-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 17467859 |
| Molecular Formula | C14H10BrNO5S2 |
| Molecular Weight | 416.27 g/mol |
| Exact Mass | 414.92 |
| IUPAC Name | 3-[(5E)-5-[(7-bromo-1,3-benzodioxol-5-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)/C(=C\c2cc(Br)c3c(c2)OCO3)SC1=S |
| InChI | InChI=1S/C14H10BrNO5S2/c15-8-3-7(4-9-12(8)21-6-20-9)5-10-13(19)16(14(22)23-10)2-1-11(17)18/h3-5H,1-2,6H2,(H,17,18)/b10-5+ |
| InChIKey | FYRMDXJWLWDFMY-BJMVGYQFSA-N |
| XLogP | 2.85 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|