C25H19ClN2O5S3 — CID 58644565
4-[3-[(5Z)-5-[[4-[5-chloro-2-(hydroxymethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid (PubChem CID 58644565) has the molecular formula C25H19ClN2O5S3 and a molecular weight of 559.09 g/mol. Its IUPAC name is 4-[3-[(5Z)-5-[[4-[5-chloro-2-(hydroxymethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid.
| Compound Name | 4-[3-[(5Z)-5-[[4-[5-chloro-2-(hydroxymethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 58644565 |
| Molecular Formula | C25H19ClN2O5S3 |
| Molecular Weight | 559.09 g/mol |
| Exact Mass | 558.01 |
| IUPAC Name | 4-[3-[(5Z)-5-[[4-[5-chloro-2-(hydroxymethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid |
| SMILES | O=C(CCN1C(=O)/C(=C/c2cc(-c3cc(Cl)ccc3CO)cs2)SC1=S)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C25H19ClN2O5S3/c26-17-4-1-15(12-29)20(10-17)16-9-19(35-13-16)11-21-23(31)28(25(34)36-21)8-7-22(30)27-18-5-2-14(3-6-18)24(32)33/h1-6,9-11,13,29H,7-8,12H2,(H,27,30)(H,32,33)/b21-11- |
| InChIKey | HKCPIEBSXRLDSQ-NHDPSOOVSA-N |
| XLogP | 5.49 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.09 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|