C30H28F3N3O4S3 — CID 58644222
tert-butyl 4-[3-[(5Z)-5-[[4-[2-(aminomethyl)-5-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoate (PubChem CID 58644222) has the molecular formula C30H28F3N3O4S3 and a molecular weight of 647.77 g/mol. Its IUPAC name is tert-butyl 4-[3-[(5Z)-5-[[4-[2-(aminomethyl)-5-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoate.
| Compound Name | tert-butyl 4-[3-[(5Z)-5-[[4-[2-(aminomethyl)-5-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoate |
|---|---|
| PubChem CID | 58644222 |
| Molecular Formula | C30H28F3N3O4S3 |
| Molecular Weight | 647.77 g/mol |
| Exact Mass | 647.12 |
| IUPAC Name | tert-butyl 4-[3-[(5Z)-5-[[4-[2-(aminomethyl)-5-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(NC(=O)CCN2C(=O)/C(=C/c3cc(-c4cc(C(F)(F)F)ccc4CN)cs3)SC2=S)cc1 |
| InChI | InChI=1S/C30H28F3N3O4S3/c1-29(2,3)40-27(39)17-5-8-21(9-6-17)35-25(37)10-11-36-26(38)24(43-28(36)41)14-22-12-19(16-42-22)23-13-20(30(31,32)33)7-4-18(23)15-34/h4-9,12-14,16H,10-11,15,34H2,1-3H3,(H,35,37)/b24-14- |
| InChIKey | AUOVHLGQMOJHPE-OYKKKHCWSA-N |
| XLogP | 7.08 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.77 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|