C25H15F6N3O4S3 — CID 58642353
4-[3-[(5Z)-5-[[4-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]pyridine-2-carboxylic acid (PubChem CID 58642353) has the molecular formula C25H15F6N3O4S3 and a molecular weight of 631.60 g/mol. Its IUPAC name is 4-[3-[(5Z)-5-[[4-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]pyridine-2-carboxylic acid.
| Compound Name | 4-[3-[(5Z)-5-[[4-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 58642353 |
| Molecular Formula | C25H15F6N3O4S3 |
| Molecular Weight | 631.60 g/mol |
| Exact Mass | 631.01 |
| IUPAC Name | 4-[3-[(5Z)-5-[[4-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]pyridine-2-carboxylic acid |
| SMILES | O=C(CCN1C(=O)/C(=C/c2cc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)cs2)SC1=S)Nc1ccnc(C(=O)O)c1 |
| InChI | InChI=1S/C25H15F6N3O4S3/c26-24(27,28)14-5-12(6-15(8-14)25(29,30)31)13-7-17(40-11-13)10-19-21(36)34(23(39)41-19)4-2-20(35)33-16-1-3-32-18(9-16)22(37)38/h1,3,5-11H,2,4H2,(H,37,38)(H,32,33,35)/b19-10- |
| InChIKey | VASMRQGTECJWRM-GRSHGNNSSA-N |
| XLogP | 6.78 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.60 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|