C24H16F2N2O5S3 — CID 58644467
4-[3-[(5E)-5-[[4-(3,5-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-2-hydroxybenzoic acid (PubChem CID 58644467) has the molecular formula C24H16F2N2O5S3 and a molecular weight of 546.60 g/mol. Its IUPAC name is 4-[3-[(5E)-5-[[4-(3,5-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-2-hydroxybenzoic acid.
| Compound Name | 4-[3-[(5E)-5-[[4-(3,5-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 58644467 |
| Molecular Formula | C24H16F2N2O5S3 |
| Molecular Weight | 546.60 g/mol |
| Exact Mass | 546.02 |
| IUPAC Name | 4-[3-[(5E)-5-[[4-(3,5-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-2-hydroxybenzoic acid |
| SMILES | O=C(CCN1C(=O)/C(=C\c2cc(-c3cc(F)cc(F)c3)cs2)SC1=S)Nc1ccc(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C24H16F2N2O5S3/c25-14-5-12(6-15(26)8-14)13-7-17(35-11-13)10-20-22(31)28(24(34)36-20)4-3-21(30)27-16-1-2-18(23(32)33)19(29)9-16/h1-2,5-11,29H,3-4H2,(H,27,30)(H,32,33)/b20-10+ |
| InChIKey | YXEFBPPNBXUVDT-KEBDBYFISA-N |
| XLogP | 5.33 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.60 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|