C26H18F2N2O6S2 — CID 58644110
4-[3-[(5Z)-5-[[3-(3,4-difluorophenyl)-4-hydroxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-2-hydroxybenzoic acid (PubChem CID 58644110) has the molecular formula C26H18F2N2O6S2 and a molecular weight of 556.57 g/mol. Its IUPAC name is 4-[3-[(5Z)-5-[[3-(3,4-difluorophenyl)-4-hydroxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-2-hydroxybenzoic acid.
| Compound Name | 4-[3-[(5Z)-5-[[3-(3,4-difluorophenyl)-4-hydroxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 58644110 |
| Molecular Formula | C26H18F2N2O6S2 |
| Molecular Weight | 556.57 g/mol |
| Exact Mass | 556.06 |
| IUPAC Name | 4-[3-[(5Z)-5-[[3-(3,4-difluorophenyl)-4-hydroxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-2-hydroxybenzoic acid |
| SMILES | O=C(CCN1C(=O)/C(=C/c2ccc(O)c(-c3ccc(F)c(F)c3)c2)SC1=S)Nc1ccc(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C26H18F2N2O6S2/c27-18-5-2-14(11-19(18)28)17-9-13(1-6-20(17)31)10-22-24(34)30(26(37)38-22)8-7-23(33)29-15-3-4-16(25(35)36)21(32)12-15/h1-6,9-12,31-32H,7-8H2,(H,29,33)(H,35,36)/b22-10- |
| InChIKey | MHMOUUFJGBCVBU-YVNNLAQVSA-N |
| XLogP | 4.97 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.57 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|