C26H19F2N3O6S3 — CID 58642220
4-[[(3S)-5-amino-3-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-5-oxopentanoyl]amino]-2-hydroxybenzoic acid (PubChem CID 58642220) has the molecular formula C26H19F2N3O6S3 and a molecular weight of 603.65 g/mol. Its IUPAC name is 4-[[(3S)-5-amino-3-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-5-oxopentanoyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[[(3S)-5-amino-3-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-5-oxopentanoyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 58642220 |
| Molecular Formula | C26H19F2N3O6S3 |
| Molecular Weight | 603.65 g/mol |
| Exact Mass | 603.04 |
| IUPAC Name | 4-[[(3S)-5-amino-3-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-5-oxopentanoyl]amino]-2-hydroxybenzoic acid |
| SMILES | NC(=O)CC(CC(=O)Nc1ccc(C(=O)O)c(O)c1)N1C(=O)/C(=C/c2cc(-c3ccc(F)c(F)c3)cs2)SC1=S |
| InChI | InChI=1S/C26H19F2N3O6S3/c27-18-4-1-12(6-19(18)28)13-5-16(39-11-13)10-21-24(35)31(26(38)40-21)15(8-22(29)33)9-23(34)30-14-2-3-17(25(36)37)20(32)7-14/h1-7,10-11,15,32H,8-9H2,(H2,29,33)(H,30,34)(H,36,37)/b21-10- |
| InChIKey | LUQXZBRKLYZAOU-FBHDLOMBSA-N |
| XLogP | 4.57 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.65 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|