C27H21F2N3O5S3 — CID 58642907
4-[[(3S)-6-amino-3-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-6-oxohexanoyl]amino]benzoic acid (PubChem CID 58642907) has the molecular formula C27H21F2N3O5S3 and a molecular weight of 601.68 g/mol. Its IUPAC name is 4-[[(3S)-6-amino-3-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-6-oxohexanoyl]amino]benzoic acid.
| Compound Name | 4-[[(3S)-6-amino-3-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-6-oxohexanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 58642907 |
| Molecular Formula | C27H21F2N3O5S3 |
| Molecular Weight | 601.68 g/mol |
| Exact Mass | 601.06 |
| IUPAC Name | 4-[[(3S)-6-amino-3-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-6-oxohexanoyl]amino]benzoic acid |
| SMILES | NC(=O)CC[C@@H](CC(=O)Nc1ccc(C(=O)O)cc1)N1C(=O)/C(=C/c2cc(-c3ccc(F)c(F)c3)cs2)SC1=S |
| InChI | InChI=1S/C27H21F2N3O5S3/c28-20-7-3-15(10-21(20)29)16-9-19(39-13-16)12-22-25(35)32(27(38)40-22)18(6-8-23(30)33)11-24(34)31-17-4-1-14(2-5-17)26(36)37/h1-5,7,9-10,12-13,18H,6,8,11H2,(H2,30,33)(H,31,34)(H,36,37)/b22-12-/t18-/m0/s1 |
| InChIKey | NWMKVFQORZWIGG-AIRTYWKNSA-N |
| XLogP | 5.26 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.68 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|