C23H14F2N4O3S3 — CID 58643156
2-[[[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]methyl]-3H-benzimidazole-5-carboxylic acid (PubChem CID 58643156) has the molecular formula C23H14F2N4O3S3 and a molecular weight of 528.59 g/mol. Its IUPAC name is 2-[[[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]methyl]-3H-benzimidazole-5-carboxylic acid.
| Compound Name | 2-[[[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]methyl]-3H-benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 58643156 |
| Molecular Formula | C23H14F2N4O3S3 |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.02 |
| IUPAC Name | 2-[[[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]methyl]-3H-benzimidazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2nc(CNN3C(=O)/C(=C/c4cc(-c5ccc(F)c(F)c5)cs4)SC3=S)[nH]c2c1 |
| InChI | InChI=1S/C23H14F2N4O3S3/c24-15-3-1-11(6-16(15)25)13-5-14(34-10-13)8-19-21(30)29(23(33)35-19)26-9-20-27-17-4-2-12(22(31)32)7-18(17)28-20/h1-8,10,26H,9H2,(H,27,28)(H,31,32)/b19-8- |
| InChIKey | SFZCUDDIZOCRQU-UWVJOHFNSA-N |
| XLogP | 5.17 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|