C21H15F6N3O5S3 — CID 58642159
(2S)-2-[[2-[[(5Z)-5-[[4-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]acetyl]amino]-3-hydroxypropanoic acid (PubChem CID 58642159) has the molecular formula C21H15F6N3O5S3 and a molecular weight of 599.56 g/mol. Its IUPAC name is (2S)-2-[[2-[[(5Z)-5-[[4-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]acetyl]amino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[[2-[[(5Z)-5-[[4-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]acetyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 58642159 |
| Molecular Formula | C21H15F6N3O5S3 |
| Molecular Weight | 599.56 g/mol |
| Exact Mass | 599.01 |
| IUPAC Name | (2S)-2-[[2-[[(5Z)-5-[[4-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]acetyl]amino]-3-hydroxypropanoic acid |
| SMILES | O=C(CNN1C(=O)/C(=C/c2cc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)cs2)SC1=S)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C21H15F6N3O5S3/c22-20(23,24)11-1-9(2-12(4-11)21(25,26)27)10-3-13(37-8-10)5-15-17(33)30(19(36)38-15)28-6-16(32)29-14(7-31)18(34)35/h1-5,8,14,28,31H,6-7H2,(H,29,32)(H,34,35)/b15-5-/t14-/m0/s1 |
| InChIKey | SORPKQHYGYRTIV-URIHLITRSA-N |
| XLogP | 3.72 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.56 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|