C19H11F6N3O3S2 — CID 58642041
2-[[(5Z)-5-[[6-[3,5-bis(trifluoromethyl)phenyl]-2-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]acetic acid (PubChem CID 58642041) has the molecular formula C19H11F6N3O3S2 and a molecular weight of 507.44 g/mol. Its IUPAC name is 2-[[(5Z)-5-[[6-[3,5-bis(trifluoromethyl)phenyl]-2-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]acetic acid.
| Compound Name | 2-[[(5Z)-5-[[6-[3,5-bis(trifluoromethyl)phenyl]-2-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]acetic acid |
|---|---|
| PubChem CID | 58642041 |
| Molecular Formula | C19H11F6N3O3S2 |
| Molecular Weight | 507.44 g/mol |
| Exact Mass | 507.01 |
| IUPAC Name | 2-[[(5Z)-5-[[6-[3,5-bis(trifluoromethyl)phenyl]-2-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]acetic acid |
| SMILES | O=C(O)CNN1C(=O)/C(=C/c2cccc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)SC1=S |
| InChI | InChI=1S/C19H11F6N3O3S2/c20-18(21,22)10-4-9(5-11(6-10)19(23,24)25)13-3-1-2-12(27-13)7-14-16(31)28(17(32)33-14)26-8-15(29)30/h1-7,26H,8H2,(H,29,30)/b14-7- |
| InChIKey | QWFLWYNMODTLFO-AUWJEWJLSA-N |
| XLogP | 4.58 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|