C27H17F7N2O4S3 — CID 58643381
2-[4-[3-[(5Z)-5-[[4-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-3-fluorophenyl]acetic acid (PubChem CID 58643381) has the molecular formula C27H17F7N2O4S3 and a molecular weight of 662.63 g/mol. Its IUPAC name is 2-[4-[3-[(5Z)-5-[[4-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-3-fluorophenyl]acetic acid.
| Compound Name | 2-[4-[3-[(5Z)-5-[[4-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-3-fluorophenyl]acetic acid |
|---|---|
| PubChem CID | 58643381 |
| Molecular Formula | C27H17F7N2O4S3 |
| Molecular Weight | 662.63 g/mol |
| Exact Mass | 662.02 |
| IUPAC Name | 2-[4-[3-[(5Z)-5-[[4-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-3-fluorophenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(NC(=O)CCN2C(=O)/C(=C/c3cc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)cs3)SC2=S)c(F)c1 |
| InChI | InChI=1S/C27H17F7N2O4S3/c28-19-5-13(6-23(38)39)1-2-20(19)35-22(37)3-4-36-24(40)21(43-25(36)41)11-18-9-15(12-42-18)14-7-16(26(29,30)31)10-17(8-14)27(32,33)34/h1-2,5,7-12H,3-4,6H2,(H,35,37)(H,38,39)/b21-11- |
| InChIKey | ZZUKZHSJLLXUHW-NHDPSOOVSA-N |
| XLogP | 7.45 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.63 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|