C31H30F2N4O5S3 — CID 58642557
4-[3-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-3-[(2-morpholin-4-ylethylamino)methyl]benzoic acid (PubChem CID 58642557) has the molecular formula C31H30F2N4O5S3 and a molecular weight of 672.80 g/mol. Its IUPAC name is 4-[3-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-3-[(2-morpholin-4-ylethylamino)methyl]benzoic acid.
| Compound Name | 4-[3-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-3-[(2-morpholin-4-ylethylamino)methyl]benzoic acid |
|---|---|
| PubChem CID | 58642557 |
| Molecular Formula | C31H30F2N4O5S3 |
| Molecular Weight | 672.80 g/mol |
| Exact Mass | 672.13 |
| IUPAC Name | 4-[3-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-3-[(2-morpholin-4-ylethylamino)methyl]benzoic acid |
| SMILES | O=C(CCN1C(=O)/C(=C/c2cc(-c3ccc(F)c(F)c3)cs2)SC1=S)Nc1ccc(C(=O)O)cc1CNCCN1CCOCC1 |
| InChI | InChI=1S/C31H30F2N4O5S3/c32-24-3-1-19(15-25(24)33)22-14-23(44-18-22)16-27-29(39)37(31(43)45-27)7-5-28(38)35-26-4-2-20(30(40)41)13-21(26)17-34-6-8-36-9-11-42-12-10-36/h1-4,13-16,18,34H,5-12,17H2,(H,35,38)(H,40,41)/b27-16- |
| InChIKey | KBZZPFAQBGTUIS-YUMHPJSZSA-N |
| XLogP | 5.04 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.80 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|