C28H24F2N4O4S3 — CID 58643953
3-[3-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-4-piperazin-1-ylbenzoic acid (PubChem CID 58643953) has the molecular formula C28H24F2N4O4S3 and a molecular weight of 614.72 g/mol. Its IUPAC name is 3-[3-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-4-piperazin-1-ylbenzoic acid.
| Compound Name | 3-[3-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-4-piperazin-1-ylbenzoic acid |
|---|---|
| PubChem CID | 58643953 |
| Molecular Formula | C28H24F2N4O4S3 |
| Molecular Weight | 614.72 g/mol |
| Exact Mass | 614.09 |
| IUPAC Name | 3-[3-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-4-piperazin-1-ylbenzoic acid |
| SMILES | O=C(CCN1C(=O)/C(=C/c2cc(-c3ccc(F)c(F)c3)cs2)SC1=S)Nc1cc(C(=O)O)ccc1N1CCNCC1 |
| InChI | InChI=1S/C28H24F2N4O4S3/c29-20-3-1-16(12-21(20)30)18-11-19(40-15-18)14-24-26(36)34(28(39)41-24)8-5-25(35)32-22-13-17(27(37)38)2-4-23(22)33-9-6-31-7-10-33/h1-4,11-15,31H,5-10H2,(H,32,35)(H,37,38)/b24-14- |
| InChIKey | IUMTZNSILQYWBH-OYKKKHCWSA-N |
| XLogP | 5.03 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.72 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|