C24H16F2N2O4S3 — CID 72763804
4-[[[2-[5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]methyl]benzoic acid (PubChem CID 72763804) has the molecular formula C24H16F2N2O4S3 and a molecular weight of 530.60 g/mol. Its IUPAC name is 4-[[[2-[5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[2-[5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 72763804 |
| Molecular Formula | C24H16F2N2O4S3 |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.02 |
| IUPAC Name | 4-[[[2-[5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]methyl]benzoic acid |
| SMILES | O=C(CN1C(=O)C(=Cc2cc(-c3ccc(F)c(F)c3)cs2)SC1=S)NCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C24H16F2N2O4S3/c25-18-6-5-15(8-19(18)26)16-7-17(34-12-16)9-20-22(30)28(24(33)35-20)11-21(29)27-10-13-1-3-14(4-2-13)23(31)32/h1-9,12H,10-11H2,(H,27,29)(H,31,32) |
| InChIKey | UUCVSBSXSVYYCC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|