C24H17F2N3O4S3 — CID 58644288
4-[[2-[[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]acetyl]amino]-3-methylbenzoic acid (PubChem CID 58644288) has the molecular formula C24H17F2N3O4S3 and a molecular weight of 545.61 g/mol. Its IUPAC name is 4-[[2-[[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]acetyl]amino]-3-methylbenzoic acid.
| Compound Name | 4-[[2-[[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]acetyl]amino]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 58644288 |
| Molecular Formula | C24H17F2N3O4S3 |
| Molecular Weight | 545.61 g/mol |
| Exact Mass | 545.03 |
| IUPAC Name | 4-[[2-[[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]acetyl]amino]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1NC(=O)CNN1C(=O)/C(=C/c2cc(-c3ccc(F)c(F)c3)cs2)SC1=S |
| InChI | InChI=1S/C24H17F2N3O4S3/c1-12-6-14(23(32)33)3-5-19(12)28-21(30)10-27-29-22(31)20(36-24(29)34)9-16-7-15(11-35-16)13-2-4-17(25)18(26)8-13/h2-9,11,27H,10H2,1H3,(H,28,30)(H,32,33)/b20-9- |
| InChIKey | RUKKWWPMZWSDPW-UKWGHVSLSA-N |
| XLogP | 5.04 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.61 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|