C23H14F2N2O4S3 — CID 72954795
4-[[2-[5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]benzoic acid (PubChem CID 72954795) has the molecular formula C23H14F2N2O4S3 and a molecular weight of 516.57 g/mol. Its IUPAC name is 4-[[2-[5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 72954795 |
| Molecular Formula | C23H14F2N2O4S3 |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.01 |
| IUPAC Name | 4-[[2-[5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]benzoic acid |
| SMILES | O=C(CN1C(=O)C(=Cc2cc(-c3ccc(F)c(F)c3)cs2)SC1=S)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H14F2N2O4S3/c24-17-6-3-13(8-18(17)25)14-7-16(33-11-14)9-19-21(29)27(23(32)34-19)10-20(28)26-15-4-1-12(2-5-15)22(30)31/h1-9,11H,10H2,(H,26,28)(H,30,31) |
| InChIKey | VQNHLFPCVIEEAQ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|