C30H27F2N3O6S3 — CID 58642271
3-[[3-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]methyl]-4-(morpholin-4-ylmethoxy)benzoic acid (PubChem CID 58642271) has the molecular formula C30H27F2N3O6S3 and a molecular weight of 659.76 g/mol. Its IUPAC name is 3-[[3-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]methyl]-4-(morpholin-4-ylmethoxy)benzoic acid.
| Compound Name | 3-[[3-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]methyl]-4-(morpholin-4-ylmethoxy)benzoic acid |
|---|---|
| PubChem CID | 58642271 |
| Molecular Formula | C30H27F2N3O6S3 |
| Molecular Weight | 659.76 g/mol |
| Exact Mass | 659.10 |
| IUPAC Name | 3-[[3-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]methyl]-4-(morpholin-4-ylmethoxy)benzoic acid |
| SMILES | O=C(CCN1C(=O)/C(=C/c2cc(-c3ccc(F)c(F)c3)cs2)SC1=S)NCc1cc(C(=O)O)ccc1OCN1CCOCC1 |
| InChI | InChI=1S/C30H27F2N3O6S3/c31-23-3-1-18(13-24(23)32)21-12-22(43-16-21)14-26-28(37)35(30(42)44-26)6-5-27(36)33-15-20-11-19(29(38)39)2-4-25(20)41-17-34-7-9-40-10-8-34/h1-4,11-14,16H,5-10,15,17H2,(H,33,36)(H,38,39)/b26-14- |
| InChIKey | RVTHVQWOPUPIIL-WGARJPEWSA-N |
| XLogP | 4.97 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.76 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|