C22H20F4N2O2S3 — CID 58643576
(5Z)-5-[[4-[4-fluoro-3-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-3-(3-morpholin-4-ylpropyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 58643576) has the molecular formula C22H20F4N2O2S3 and a molecular weight of 516.61 g/mol. Its IUPAC name is (5Z)-5-[[4-[4-fluoro-3-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-3-(3-morpholin-4-ylpropyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-[4-fluoro-3-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-3-(3-morpholin-4-ylpropyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 58643576 |
| Molecular Formula | C22H20F4N2O2S3 |
| Molecular Weight | 516.61 g/mol |
| Exact Mass | 516.06 |
| IUPAC Name | (5Z)-5-[[4-[4-fluoro-3-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-3-(3-morpholin-4-ylpropyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cc(-c3ccc(F)c(C(F)(F)F)c3)cs2)SC(=S)N1CCCN1CCOCC1 |
| InChI | InChI=1S/C22H20F4N2O2S3/c23-18-3-2-14(11-17(18)22(24,25)26)15-10-16(32-13-15)12-19-20(29)28(21(31)33-19)5-1-4-27-6-8-30-9-7-27/h2-3,10-13H,1,4-9H2/b19-12- |
| InChIKey | MOHAJPSWICYSIW-UNOMPAQXSA-N |
| XLogP | 5.50 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.61 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|