C24H21F4N3O4S3 — CID 58644267
(2S,4S)-4-[3-[(5Z)-5-[[4-[4-fluoro-3-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]piperidine-2-carboxylic acid (PubChem CID 58644267) has the molecular formula C24H21F4N3O4S3 and a molecular weight of 587.64 g/mol. Its IUPAC name is (2S,4S)-4-[3-[(5Z)-5-[[4-[4-fluoro-3-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]piperidine-2-carboxylic acid.
| Compound Name | (2S,4S)-4-[3-[(5Z)-5-[[4-[4-fluoro-3-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 58644267 |
| Molecular Formula | C24H21F4N3O4S3 |
| Molecular Weight | 587.64 g/mol |
| Exact Mass | 587.06 |
| IUPAC Name | (2S,4S)-4-[3-[(5Z)-5-[[4-[4-fluoro-3-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]piperidine-2-carboxylic acid |
| SMILES | O=C(CCN1C(=O)/C(=C/c2cc(-c3ccc(F)c(C(F)(F)F)c3)cs2)SC1=S)N[C@H]1CCN[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C24H21F4N3O4S3/c25-17-2-1-12(8-16(17)24(26,27)28)13-7-15(37-11-13)10-19-21(33)31(23(36)38-19)6-4-20(32)30-14-3-5-29-18(9-14)22(34)35/h1-2,7-8,10-11,14,18,29H,3-6,9H2,(H,30,32)(H,34,35)/b19-10-/t14-,18-/m0/s1 |
| InChIKey | ATHIVDIXDSEETE-ZKGIGPEPSA-N |
| XLogP | 4.49 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.64 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|