C22H18F4N2O5S3 — CID 58643779
(2R,3R)-3-[3-[(5Z)-5-[[4-[4-fluoro-3-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-2-hydroxybutanoic acid (PubChem CID 58643779) has the molecular formula C22H18F4N2O5S3 and a molecular weight of 562.59 g/mol. Its IUPAC name is (2R,3R)-3-[3-[(5Z)-5-[[4-[4-fluoro-3-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-2-hydroxybutanoic acid.
| Compound Name | (2R,3R)-3-[3-[(5Z)-5-[[4-[4-fluoro-3-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 58643779 |
| Molecular Formula | C22H18F4N2O5S3 |
| Molecular Weight | 562.59 g/mol |
| Exact Mass | 562.03 |
| IUPAC Name | (2R,3R)-3-[3-[(5Z)-5-[[4-[4-fluoro-3-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-2-hydroxybutanoic acid |
| SMILES | C[C@@H](NC(=O)CCN1C(=O)/C(=C/c2cc(-c3ccc(F)c(C(F)(F)F)c3)cs2)SC1=S)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C22H18F4N2O5S3/c1-10(18(30)20(32)33)27-17(29)4-5-28-19(31)16(36-21(28)34)8-13-6-12(9-35-13)11-2-3-15(23)14(7-11)22(24,25)26/h2-3,6-10,18,30H,4-5H2,1H3,(H,27,29)(H,32,33)/b16-8-/t10-,18-/m1/s1 |
| InChIKey | LHRBKSRQNNTPEQ-NQMKPWEJSA-N |
| XLogP | 4.11 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.59 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|