C25H16F4N2O5S2 — CID 58642819
4-[3-[(5Z)-5-[[5-[4-fluoro-3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid (PubChem CID 58642819) has the molecular formula C25H16F4N2O5S2 and a molecular weight of 564.54 g/mol. Its IUPAC name is 4-[3-[(5Z)-5-[[5-[4-fluoro-3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid.
| Compound Name | 4-[3-[(5Z)-5-[[5-[4-fluoro-3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 58642819 |
| Molecular Formula | C25H16F4N2O5S2 |
| Molecular Weight | 564.54 g/mol |
| Exact Mass | 564.04 |
| IUPAC Name | 4-[3-[(5Z)-5-[[5-[4-fluoro-3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid |
| SMILES | O=C(CCN1C(=O)/C(=C/c2ccc(-c3ccc(F)c(C(F)(F)F)c3)o2)SC1=S)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C25H16F4N2O5S2/c26-18-7-3-14(11-17(18)25(27,28)29)19-8-6-16(36-19)12-20-22(33)31(24(37)38-20)10-9-21(32)30-15-4-1-13(2-5-15)23(34)35/h1-8,11-12H,9-10H2,(H,30,32)(H,34,35)/b20-12- |
| InChIKey | PMDXFGUQXACLCR-NDENLUEZSA-N |
| XLogP | 6.03 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.54 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|