C19H13F4NO5S — CID 58642847
4-[(5E)-5-[[5-[4-fluoro-3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 58642847) has the molecular formula C19H13F4NO5S and a molecular weight of 443.37 g/mol. Its IUPAC name is 4-[(5E)-5-[[5-[4-fluoro-3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 4-[(5E)-5-[[5-[4-fluoro-3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 58642847 |
| Molecular Formula | C19H13F4NO5S |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | 4-[(5E)-5-[[5-[4-fluoro-3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)S/C(=C/c2ccc(-c3ccc(F)c(C(F)(F)F)c3)o2)C1=O |
| InChI | InChI=1S/C19H13F4NO5S/c20-13-5-3-10(8-12(13)19(21,22)23)14-6-4-11(29-14)9-15-17(27)24(18(28)30-15)7-1-2-16(25)26/h3-6,8-9H,1-2,7H2,(H,25,26)/b15-9+ |
| InChIKey | HEAYCWHQHWNOMS-OQLLNIDSSA-N |
| XLogP | 5.01 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|